![4-[(4-amino-3-ethylphenyl)methyl]-2-ethylaniline (CAS: 19900-65-3) - Chemical Structure and Molecular Formula](/static/img/prod-pic/FT-0738790.gif "4-[(4-amino-3-ethylphenyl)methyl]-2-ethylaniline chemical structure")
4-[(4-amino-3-ethylphenyl)methyl]-2-ethylaniline
Catalog No: FT-0738790
CAS No: 19900-65-3
- Chemical Name: 4-[(4-amino-3-ethylphenyl)methyl]-2-ethylaniline
- Molecular Formula: C17H22N2
- Molecular Weight: 254.37
- InChI Key: CBEVWPCAHIAUOD-UHFFFAOYSA-N
- InChI: InChI=1S/C17H22N2/c1-3-14-10-12(5-7-16(14)18)9-13-6-8-17(19)15(4-2)11-13/h5-8,10-11H,3-4,9,18-19H2,1-2H3
| Assay | Pack Size | Price | Stock | Action |
|---|---|---|---|---|
| 98% | 1g | N/A | N/A | |
| 98% | 5g | N/A | N/A | |
| 98% | Bulk Quantity | N/A | N/A |
| Product_Name: | 4,4'-Methylenebis(2-ethylaniline) |
|---|---|
| MF: | C17H22N2 |
| Bolling_Point: | 426.0±40.0 °C at 760 mmHg |
| Density: | 1.1±0.1 g/cm3 |
| FW: | 254.370 |
| Melting_Point: | N/A |
| Flash_Point: | 253.3±26.8 °C |
| CAS: | 19900-65-3 |
| MF: | C17H22N2 |
|---|---|
| Refractive_Index: | 1.612 |
| Flash_Point: | 253.3±26.8 °C |
| PSA: | 52.04000 |
| Bolling_Point: | 426.0±40.0 °C at 760 mmHg |
| Density: | 1.1±0.1 g/cm3 |
| Exact_Mass: | 254.178299 |
| FW: | 254.370 |
| LogP: | 3.63 |
| Vapor_Pressure: | 0.0±1.0 mmHg at 25°C |
| Risk_Statements(EU): | R22 |
|---|---|
| Hazard_Codes: | Xn: Harmful;N: Dangerous for the environment; |
| HS_Code: | 2921590090 |
| Safety_Statements: | 36/37-60-61 |
